C44H22N2 — CID 156680894
3-[15-(3-isocyanophenyl)-3-octacyclo[16.10.1.15,9.02,16.04,14.019,24.025,29.013,30]triaconta-1(28),2(16),3,5,7,9(30),10,12,14,17,19,21,23,25(29),26-pentadecaenyl]benzonitrile (PubChem CID 156680894) has the molecular formula C44H22N2 and a molecular weight of 578.67 g/mol. Its IUPAC name is 3-[15-(3-isocyanophenyl)-3-octacyclo[16.10.1.15,9.02,16.04,14.019,24.025,29.013,30]triaconta-1(28),2(16),3,5,7,9(30),10,12,14,17,19,21,23,25(29),26-pentadecaenyl]benzonitrile.
| Compound Name | 3-[15-(3-isocyanophenyl)-3-octacyclo[16.10.1.15,9.02,16.04,14.019,24.025,29.013,30]triaconta-1(28),2(16),3,5,7,9(30),10,12,14,17,19,21,23,25(29),26-pentadecaenyl]benzonitrile |
|---|---|
| PubChem CID | 156680894 |
| Molecular Formula | C44H22N2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 3-[15-(3-isocyanophenyl)-3-octacyclo[16.10.1.15,9.02,16.04,14.019,24.025,29.013,30]triaconta-1(28),2(16),3,5,7,9(30),10,12,14,17,19,21,23,25(29),26-pentadecaenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2c3cc4c5ccccc5c5cccc(c3c(-c3cccc(C#N)c3)c3c6cccc7cccc(c23)c76)c54)c1 |
| InChI | InChI=1S/C44H22N2/c1-46-29-14-5-13-28(22-29)39-37-23-36-31-16-3-2-15-30(31)32-17-8-20-35(41(32)36)42(37)40(27-12-4-9-25(21-27)24-45)44-34-19-7-11-26-10-6-18-33(38(26)34)43(39)44/h2-23H |
| InChIKey | LPBZNKYJKGQEDP-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|