About (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium
(4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium (PubChem CID 156680922) has the molecular formula C8H15N2+
and a molecular weight of 139.22 g/mol. Its IUPAC name is (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium.
Molecular Properties
| Compound Name | (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium |
| PubChem CID | 156680922 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium |
| SMILES | CC1=CC(C)=C(C[NH3+])CN1 |
| InChI | InChI=1S/C8H14N2/c1-6-3-7(2)10-5-8(6)4-9/h3,10H,4-5,9H2,1-2H3/p+1 |
| InChIKey | YGAJDFDMECYUAW-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium?
The IUPAC name of (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium (CID 156680922) is (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium.
What is the SMILES notation for (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium?
The canonical SMILES for (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium is CC1=CC(C)=C(C[NH3+])CN1.
What is the InChIKey of (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium?
The InChIKey is YGAJDFDMECYUAW-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H14N2/c1-6-3-7(2)10-5-8(6)4-9/h3,10H,4-5,9H2,1-2H3/p+1.
What are the key properties of (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium?
(4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium has a molecular weight of 139.22 g/mol, XLogP of 0.05, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethyl-1,2-dihydropyridin-3-yl)methylazanium is sourced from PubChem (CID 156680922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).