About 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol
3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 156681794) has the molecular formula C11H20O3S
and a molecular weight of 232.34 g/mol. Its IUPAC name is 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 156681794 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)(C)C1(O)CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C11H20O3S/c1-10(2,3)11(12)6-8-4-5-9(7-11)15(8,13)14/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | HFIFFDMCSDVOTF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (CID 156681794) is 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol is CC(C)(C)C1(O)CC2CCC(C1)S2(=O)=O.
What is the InChIKey of 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is HFIFFDMCSDVOTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3S/c1-10(2,3)11(12)6-8-4-5-9(7-11)15(8,13)14/h8-9,12H,4-7H2,1-3H3.
What are the key properties of 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 232.34 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 156681794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).