About CID 156681870
CID 156681870 (PubChem CID 156681870) has the molecular formula C6H15NO2Si2
and a molecular weight of 189.36 g/mol.
Molecular Properties
| Compound Name | CID 156681870 |
| PubChem CID | 156681870 |
| Molecular Formula | C6H15NO2Si2 |
| Molecular Weight | 189.36 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | — |
| SMILES | CCO[Si]CC(N)[Si]OCC |
| InChI | InChI=1S/C6H15NO2Si2/c1-3-8-10-5-6(7)11-9-4-2/h6H,3-5,7H2,1-2H3 |
| InChIKey | OQXHCMJAFRZNDO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.36 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156681870 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156681870?
The IUPAC name of CID 156681870 (CID 156681870) is not available.
What is the SMILES notation for CID 156681870?
The canonical SMILES for CID 156681870 is CCO[Si]CC(N)[Si]OCC.
What is the InChIKey of CID 156681870?
The InChIKey is OQXHCMJAFRZNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2Si2/c1-3-8-10-5-6(7)11-9-4-2/h6H,3-5,7H2,1-2H3.
What are the key properties of CID 156681870?
CID 156681870 has a molecular weight of 189.36 g/mol, XLogP of 0.00, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156681870 is sourced from PubChem (CID 156681870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).