C18H9F3N6 — CID 156681929
2,4,6-tris(3-fluoro-4-pyridinyl)-1,3,5-triazine (PubChem CID 156681929) has the molecular formula C18H9F3N6 and a molecular weight of 366.31 g/mol. Its IUPAC name is 2,4,6-tris(3-fluoro-4-pyridinyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3-fluoro-4-pyridinyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 156681929 |
| Molecular Formula | C18H9F3N6 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2,4,6-tris(3-fluoro-4-pyridinyl)-1,3,5-triazine |
| SMILES | Fc1cnccc1-c1nc(-c2ccncc2F)nc(-c2ccncc2F)n1 |
| InChI | InChI=1S/C18H9F3N6/c19-13-7-22-4-1-10(13)16-25-17(11-2-5-23-8-14(11)20)27-18(26-16)12-3-6-24-9-15(12)21/h1-9H |
| InChIKey | RUJXCTNVATTWKX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |