About azanide;dichlororuthenium;propane
azanide;dichlororuthenium;propane (PubChem CID 156682028) has the molecular formula C3H8Cl2NRu-3
and a molecular weight of 230.08 g/mol. Its IUPAC name is azanide;dichlororuthenium;propane.
Molecular Properties
| Compound Name | azanide;dichlororuthenium;propane |
| PubChem CID | 156682028 |
| Molecular Formula | C3H8Cl2NRu-3 |
| Molecular Weight | 230.08 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | azanide;dichlororuthenium;propane |
| SMILES | Cl[Ru]Cl.[CH2-]C[CH2-].[NH2-] |
| InChI | InChI=1S/C3H6.2ClH.H2N.Ru/c1-3-2;;;;/h1-3H2;2*1H;1H2;/q-2;;;-1;+2/p-2 |
| InChIKey | MGXKJIZOFATEEY-UHFFFAOYSA-L |
| XLogP | 3.14 |
| TPSA | 33.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze azanide;dichlororuthenium;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;dichlororuthenium;propane?
The IUPAC name of azanide;dichlororuthenium;propane (CID 156682028) is azanide;dichlororuthenium;propane.
What is the SMILES notation for azanide;dichlororuthenium;propane?
The canonical SMILES for azanide;dichlororuthenium;propane is Cl[Ru]Cl.[CH2-]C[CH2-].[NH2-].
What is the InChIKey of azanide;dichlororuthenium;propane?
The InChIKey is MGXKJIZOFATEEY-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6.2ClH.H2N.Ru/c1-3-2;;;;/h1-3H2;2*1H;1H2;/q-2;;;-1;+2/p-2.
What are the key properties of azanide;dichlororuthenium;propane?
azanide;dichlororuthenium;propane has a molecular weight of 230.08 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;dichlororuthenium;propane is sourced from PubChem (CID 156682028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).