C23H24BF2N2+ — CID 156682075
difluoro-[2-[(Z)-[1-methyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]pyrrol-1-ium-2-ylidene]methyl]-5-propylpyrrol-1-yl]borane (PubChem CID 156682075) has the molecular formula C23H24BF2N2+ and a molecular weight of 377.27 g/mol. Its IUPAC name is difluoro-[2-[(Z)-[1-methyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]pyrrol-1-ium-2-ylidene]methyl]-5-propylpyrrol-1-yl]borane.
| Compound Name | difluoro-[2-[(Z)-[1-methyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]pyrrol-1-ium-2-ylidene]methyl]-5-propylpyrrol-1-yl]borane |
|---|---|
| PubChem CID | 156682075 |
| Molecular Formula | C23H24BF2N2+ |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | difluoro-[2-[(Z)-[1-methyl-5-[(1E,3E)-4-phenylbuta-1,3-dienyl]pyrrol-1-ium-2-ylidene]methyl]-5-propylpyrrol-1-yl]borane |
| SMILES | CCCc1ccc(/C=C2/C=CC(/C=C/C=C/c3ccccc3)=[N+]2C)n1B(F)F |
| InChI | InChI=1S/C23H24BF2N2/c1-3-9-21-15-17-23(28(21)24(25)26)18-22-16-14-20(27(22)2)13-8-7-12-19-10-5-4-6-11-19/h4-8,10-18H,3,9H2,1-2H3/q+1/b12-7+,13-8+ |
| InChIKey | SWVSGJSIIOAZFI-INOXDZRUSA-N |
| XLogP | 5.48 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|