C27H33N7O7S — CID 156682092
(2,5-dioxopyrrolidin-1-yl) 4-[4-oxo-4-(pentylamino)butanoyl]sulfanyl-3-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]butanoate (PubChem CID 156682092) has the molecular formula C27H33N7O7S and a molecular weight of 599.67 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[4-oxo-4-(pentylamino)butanoyl]sulfanyl-3-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-oxo-4-(pentylamino)butanoyl]sulfanyl-3-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 156682092 |
| Molecular Formula | C27H33N7O7S |
| Molecular Weight | 599.67 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-oxo-4-(pentylamino)butanoyl]sulfanyl-3-[[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]butanoate |
| SMILES | CCCCCNC(=O)CCC(=O)SCC(CC(=O)ON1C(=O)CCC1=O)NC(=O)Cc1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C27H33N7O7S/c1-2-3-4-13-28-21(35)9-12-26(40)42-16-20(15-25(39)41-34-23(37)10-11-24(34)38)31-22(36)14-18-5-7-19(8-6-18)27-32-29-17-30-33-27/h5-8,17,20H,2-4,9-16H2,1H3,(H,28,35)(H,31,36) |
| InChIKey | WZYNNPVXWWNTLA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 190.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|