C13H20O6 — CID 156682200
(2S,6R,8S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxylic acid (PubChem CID 156682200) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S,6R,8S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxylic acid.
| Compound Name | (2S,6R,8S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxylic acid |
|---|---|
| PubChem CID | 156682200 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2S,6R,8S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[6.4.0.02,6]dodecane-6-carboxylic acid |
| SMILES | CC1(C)OC[C@@H]2C[C@@]3(C(=O)O)OC(C)(C)O[C@H]3C2O1 |
| InChI | InChI=1S/C13H20O6/c1-11(2)16-6-7-5-13(10(14)15)9(8(7)17-11)18-12(3,4)19-13/h7-9H,5-6H2,1-4H3,(H,14,15)/t7-,8?,9-,13+/m0/s1 |
| InChIKey | KYKMMVUXQKONBP-QLSXPOQTSA-N |
| XLogP | 1.13 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |