About [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol
[trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol (PubChem CID 156682210) has the molecular formula C14H12F6O3S2
and a molecular weight of 406.37 g/mol. Its IUPAC name is [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol.
Molecular Properties
| Compound Name | [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol |
| PubChem CID | 156682210 |
| Molecular Formula | C14H12F6O3S2 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol |
| SMILES | O=S(=O)(C(O)S(F)(F)(F)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H12F6O3S2/c15-14(16,17)24(22,23)13(21)25(18,19,20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,21H |
| InChIKey | WKTLCTGCUICTFE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol?
The IUPAC name of [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol (CID 156682210) is [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol.
What is the SMILES notation for [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol?
The canonical SMILES for [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol is O=S(=O)(C(O)S(F)(F)(F)(c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol?
The InChIKey is WKTLCTGCUICTFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F6O3S2/c15-14(16,17)24(22,23)13(21)25(18,19,20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,21H.
What are the key properties of [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol?
[trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol has a molecular weight of 406.37 g/mol, XLogP of 4.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [trifluoro(diphenyl)-λ6-sulfanyl]-(trifluoromethylsulfonyl)methanol is sourced from PubChem (CID 156682210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).