C15H20BFN2O4S — CID 156682211
1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 156682211) has the molecular formula C15H20BFN2O4S and a molecular weight of 354.21 g/mol. Its IUPAC name is 1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 156682211 |
| Molecular Formula | C15H20BFN2O4S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-ethylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CCS(=O)(=O)n1ncc2c(B3OC(C)(C)C(C)(C)O3)cc(F)cc21 |
| InChI | InChI=1S/C15H20BFN2O4S/c1-6-24(20,21)19-13-8-10(17)7-12(11(13)9-18-19)16-22-14(2,3)15(4,5)23-16/h7-9H,6H2,1-5H3 |
| InChIKey | KWHXJXVRFUNVQC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|