About 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate
2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate (PubChem CID 156682382) has the molecular formula C13H20O2S
and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate |
| PubChem CID | 156682382 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)(C)C1CC2C=CC1S2 |
| InChI | InChI=1S/C13H20O2S/c1-8(2)12(14)15-13(3,4)10-7-9-5-6-11(10)16-9/h5-6,8-11H,7H2,1-4H3 |
| InChIKey | UWTFUQSMMFSDTG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate?
The IUPAC name of 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate (CID 156682382) is 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate.
What is the SMILES notation for 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate?
The canonical SMILES for 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate is CC(C)C(=O)OC(C)(C)C1CC2C=CC1S2.
What is the InChIKey of 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate?
The InChIKey is UWTFUQSMMFSDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-8(2)12(14)15-13(3,4)10-7-9-5-6-11(10)16-9/h5-6,8-11H,7H2,1-4H3.
What are the key properties of 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate?
2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate has a molecular weight of 240.37 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-thiabicyclo[2.2.1]hept-5-en-2-yl)propan-2-yl 2-methylpropanoate is sourced from PubChem (CID 156682382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).