C17H33NO3 — CID 156682824
4-(2,2-dimethylpropyl)-N-[2-(2-methoxyethoxy)ethyl]cyclohexane-1-carboxamide (PubChem CID 156682824) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-N-[2-(2-methoxyethoxy)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(2,2-dimethylpropyl)-N-[2-(2-methoxyethoxy)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 156682824 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-N-[2-(2-methoxyethoxy)ethyl]cyclohexane-1-carboxamide |
| SMILES | COCCOCCNC(=O)C1CCC(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33NO3/c1-17(2,3)13-14-5-7-15(8-6-14)16(19)18-9-10-21-12-11-20-4/h14-15H,5-13H2,1-4H3,(H,18,19) |
| InChIKey | KEJCEUAIHBUCHO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|