C18H35NO3 — CID 156682837
2-[4-(2,2-dimethylpropyl)cyclohexyl]-N-[2-(2-methoxyethoxy)ethyl]acetamide (PubChem CID 156682837) has the molecular formula C18H35NO3 and a molecular weight of 313.48 g/mol. Its IUPAC name is 2-[4-(2,2-dimethylpropyl)cyclohexyl]-N-[2-(2-methoxyethoxy)ethyl]acetamide.
| Compound Name | 2-[4-(2,2-dimethylpropyl)cyclohexyl]-N-[2-(2-methoxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 156682837 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | 2-[4-(2,2-dimethylpropyl)cyclohexyl]-N-[2-(2-methoxyethoxy)ethyl]acetamide |
| SMILES | COCCOCCNC(=O)CC1CCC(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H35NO3/c1-18(2,3)14-16-7-5-15(6-8-16)13-17(20)19-9-10-22-12-11-21-4/h15-16H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | DOABQHHAWKADCK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|