C28H20Br2O8 — CID 156682840
6,20-dibromo-7,19-dihydroxy-5,21-bis(hydroxymethyl)-10,16-dimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,12,15,18(23),19,21-decaene-9,17-dione (PubChem CID 156682840) has the molecular formula C28H20Br2O8 and a molecular weight of 644.27 g/mol. Its IUPAC name is 6,20-dibromo-7,19-dihydroxy-5,21-bis(hydroxymethyl)-10,16-dimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,12,15,18(23),19,21-decaene-9,17-dione.
| Compound Name | 6,20-dibromo-7,19-dihydroxy-5,21-bis(hydroxymethyl)-10,16-dimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,12,15,18(23),19,21-decaene-9,17-dione |
|---|---|
| PubChem CID | 156682840 |
| Molecular Formula | C28H20Br2O8 |
| Molecular Weight | 644.27 g/mol |
| Exact Mass | 641.95 |
| IUPAC Name | 6,20-dibromo-7,19-dihydroxy-5,21-bis(hydroxymethyl)-10,16-dimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,12,15,18(23),19,21-decaene-9,17-dione |
| SMILES | COc1c2c3c4c(c(OC)c(=O)c5c(O)c(Br)c(CO)c(c6c(CO)c(Br)c(O)c(c1=O)c36)c54)CC(C)=C2 |
| InChI | InChI=1S/C28H20Br2O8/c1-8-4-9-13-14-10(5-8)28(38-3)26(36)20-18(14)16(12(7-32)22(30)24(20)34)15-11(6-31)21(29)23(33)19(17(13)15)25(35)27(9)37-2/h4,31-34H,5-7H2,1-3H3 |
| InChIKey | FCGKROAGYLIRBM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|