C27H27N7O2 — CID 156683026
7-(4-aminoanilino)-3-(2,6-dimethylphenyl)-1-(5-methoxy-2-pyridinyl)-4-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 156683026) has the molecular formula C27H27N7O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 7-(4-aminoanilino)-3-(2,6-dimethylphenyl)-1-(5-methoxy-2-pyridinyl)-4-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 7-(4-aminoanilino)-3-(2,6-dimethylphenyl)-1-(5-methoxy-2-pyridinyl)-4-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 156683026 |
| Molecular Formula | C27H27N7O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 7-(4-aminoanilino)-3-(2,6-dimethylphenyl)-1-(5-methoxy-2-pyridinyl)-4-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | COc1ccc(N2C(=O)N(c3c(C)cccc3C)C(C)c3cnc(Nc4ccc(N)cc4)nc32)nc1 |
| InChI | InChI=1S/C27H27N7O2/c1-16-6-5-7-17(2)24(16)33-18(3)22-15-30-26(31-20-10-8-19(28)9-11-20)32-25(22)34(27(33)35)23-13-12-21(36-4)14-29-23/h5-15,18H,28H2,1-4H3,(H,30,31,32) |
| InChIKey | VNCVFVJBUSLPMJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|