C36H41N2O4+ — CID 156683067
[2-[2-(2-methoxyethoxy)ethoxy]-5-[2-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]phenyl]methyl-methylidene-phenylazanium (PubChem CID 156683067) has the molecular formula C36H41N2O4+ and a molecular weight of 565.73 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)ethoxy]-5-[2-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]phenyl]methyl-methylidene-phenylazanium.
| Compound Name | [2-[2-(2-methoxyethoxy)ethoxy]-5-[2-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]phenyl]methyl-methylidene-phenylazanium |
|---|---|
| PubChem CID | 156683067 |
| Molecular Formula | C36H41N2O4+ |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)ethoxy]-5-[2-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]phenyl]methyl-methylidene-phenylazanium |
| SMILES | C=[N+](Cc1cc(C(C)(C)c2ccc3c(c2)CN(c2ccccc2)CO3)ccc1OCCOCCOC)c1ccccc1 |
| InChI | InChI=1S/C36H41N2O4/c1-36(2,31-16-18-35-29(24-31)26-38(27-42-35)33-13-9-6-10-14-33)30-15-17-34(41-22-21-40-20-19-39-4)28(23-30)25-37(3)32-11-7-5-8-12-32/h5-18,23-24H,3,19-22,25-27H2,1-2,4H3/q+1 |
| InChIKey | OLZZCXDXZLIZHE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|