C14H25F3N3O3P — CID 156683113
N-[(2S)-1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-deuteriopropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 156683113) has the molecular formula C14H25F3N3O3P and a molecular weight of 372.35 g/mol. Its IUPAC name is N-[(2S)-1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-deuteriopropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S)-1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-deuteriopropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 156683113 |
| Molecular Formula | C14H25F3N3O3P |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[(2S)-1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-deuteriopropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | [2H]C[C@@H](COP(OCCC#N)N(C(C)C)C(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H25F3N3O3P/c1-10(2)20(11(3)4)24(22-8-6-7-18)23-9-12(5)19-13(21)14(15,16)17/h10-12H,6,8-9H2,1-5H3,(H,19,21)/t12-,24?/m0/s1/i5D |
| InChIKey | YKSHEIQUTSBRET-BQYQFKBCSA-N |
| XLogP | 3.35 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|