About [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium
[4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium (PubChem CID 156684034) has the molecular formula C21H16Br2FO2S+
and a molecular weight of 511.23 g/mol. Its IUPAC name is [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium.
Molecular Properties
| Compound Name | [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium |
| PubChem CID | 156684034 |
| Molecular Formula | C21H16Br2FO2S+ |
| Molecular Weight | 511.23 g/mol |
| Exact Mass | 508.92 |
| IUPAC Name | [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium |
| SMILES | O=C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1F)C(Br)CBr |
| InChI | InChI=1S/C21H16Br2FO2S/c22-14-18(23)21(25)26-20-12-11-17(13-19(20)24)27(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,18H,14H2/q+1 |
| InChIKey | GAGKWOPTCZBCFO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.23 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium?
The IUPAC name of [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium (CID 156684034) is [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium.
What is the SMILES notation for [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium?
The canonical SMILES for [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium is O=C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1F)C(Br)CBr.
What is the InChIKey of [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium?
The InChIKey is GAGKWOPTCZBCFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Br2FO2S/c22-14-18(23)21(25)26-20-12-11-17(13-19(20)24)27(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,18H,14H2/q+1.
What are the key properties of [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium?
[4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium has a molecular weight of 511.23 g/mol, XLogP of 5.98, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-dibromopropanoyloxy)-3-fluorophenyl]-diphenylsulfanium is sourced from PubChem (CID 156684034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).