C13H16BrFO3S — CID 156684484
4-[(4-bromo-2-fluorophenyl)sulfonylmethyl]-4-methyloxane (PubChem CID 156684484) has the molecular formula C13H16BrFO3S and a molecular weight of 351.24 g/mol. Its IUPAC name is 4-[(4-bromo-2-fluorophenyl)sulfonylmethyl]-4-methyloxane.
| Compound Name | 4-[(4-bromo-2-fluorophenyl)sulfonylmethyl]-4-methyloxane |
|---|---|
| PubChem CID | 156684484 |
| Molecular Formula | C13H16BrFO3S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 4-[(4-bromo-2-fluorophenyl)sulfonylmethyl]-4-methyloxane |
| SMILES | CC1(CS(=O)(=O)c2ccc(Br)cc2F)CCOCC1 |
| InChI | InChI=1S/C13H16BrFO3S/c1-13(4-6-18-7-5-13)9-19(16,17)12-3-2-10(14)8-11(12)15/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | YMPLTJNKHIEBPF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |