C28H33F2O7- — CID 156684592
3-cyclohexyl-2,2-difluoro-3-[4-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyloxy]benzoyl]oxypropanoate (PubChem CID 156684592) has the molecular formula C28H33F2O7- and a molecular weight of 519.56 g/mol. Its IUPAC name is 3-cyclohexyl-2,2-difluoro-3-[4-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyloxy]benzoyl]oxypropanoate.
| Compound Name | 3-cyclohexyl-2,2-difluoro-3-[4-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyloxy]benzoyl]oxypropanoate |
|---|---|
| PubChem CID | 156684592 |
| Molecular Formula | C28H33F2O7- |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 3-cyclohexyl-2,2-difluoro-3-[4-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyloxy]benzoyl]oxypropanoate |
| SMILES | CC1(OC(=O)Oc2ccc(C(=O)OC(C3CCCCC3)C(F)(F)C(=O)[O-])cc2)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C28H34F2O7/c1-27(15-18-14-22(27)21-9-5-8-20(18)21)37-26(34)35-19-12-10-17(11-13-19)24(31)36-23(28(29,30)25(32)33)16-6-3-2-4-7-16/h10-13,16,18,20-23H,2-9,14-15H2,1H3,(H,32,33)/p-1 |
| InChIKey | LBVVJYOIHYTASD-UHFFFAOYSA-M |
| XLogP | 4.91 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|