C30H35F2O7- — CID 156684602
3-cyclohexyl-2,2-difluoro-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypropanoate (PubChem CID 156684602) has the molecular formula C30H35F2O7- and a molecular weight of 545.60 g/mol. Its IUPAC name is 3-cyclohexyl-2,2-difluoro-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypropanoate.
| Compound Name | 3-cyclohexyl-2,2-difluoro-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypropanoate |
|---|---|
| PubChem CID | 156684602 |
| Molecular Formula | C30H35F2O7- |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 3-cyclohexyl-2,2-difluoro-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypropanoate |
| SMILES | CC1(OC(=O)Oc2ccc(C(=O)OC(C3CCCCC3)C(F)(F)C(=O)[O-])cc2)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C30H36F2O7/c1-29(15-20-14-22(29)24-19-8-7-18(13-19)23(20)24)39-28(36)37-21-11-9-17(10-12-21)26(33)38-25(30(31,32)27(34)35)16-5-3-2-4-6-16/h9-12,16,18-20,22-25H,2-8,13-15H2,1H3,(H,34,35)/p-1 |
| InChIKey | JJZWVIIBLYKBCY-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|