C30H33F2O6- — CID 156684777
2,2-difluoro-3-[4-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxy-3-phenylpropanoate (PubChem CID 156684777) has the molecular formula C30H33F2O6- and a molecular weight of 527.58 g/mol. Its IUPAC name is 2,2-difluoro-3-[4-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxy-3-phenylpropanoate.
| Compound Name | 2,2-difluoro-3-[4-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 156684777 |
| Molecular Formula | C30H33F2O6- |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 2,2-difluoro-3-[4-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxy-3-phenylpropanoate |
| SMILES | CC(C)C(Oc1ccc(C(=O)OC(c2ccccc2)C(F)(F)C(=O)[O-])cc1)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C30H34F2O6/c1-17(2)28(37-25-16-20-15-24(25)23-10-6-9-22(20)23)36-21-13-11-19(12-14-21)27(33)38-26(30(31,32)29(34)35)18-7-4-3-5-8-18/h3-5,7-8,11-14,17,20,22-26,28H,6,9-10,15-16H2,1-2H3,(H,34,35)/p-1 |
| InChIKey | NKOHYGRMUSEMQW-UHFFFAOYSA-M |
| XLogP | 5.17 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|