C14H19F2O4- — CID 156684874
2,2-difluoro-2-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,3'-cyclohexane]-1'-ylacetate (PubChem CID 156684874) has the molecular formula C14H19F2O4- and a molecular weight of 289.30 g/mol. Its IUPAC name is 2,2-difluoro-2-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,3'-cyclohexane]-1'-ylacetate.
| Compound Name | 2,2-difluoro-2-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,3'-cyclohexane]-1'-ylacetate |
|---|---|
| PubChem CID | 156684874 |
| Molecular Formula | C14H19F2O4- |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2,2-difluoro-2-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,3'-cyclohexane]-1'-ylacetate |
| SMILES | O=C([O-])C(F)(F)C1CCCC2(C1)OC1CCCCC1O2 |
| InChI | InChI=1S/C14H20F2O4/c15-14(16,12(17)18)9-4-3-7-13(8-9)19-10-5-1-2-6-11(10)20-13/h9-11H,1-8H2,(H,17,18)/p-1 |
| InChIKey | BWBWLEIHSDKSII-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |