C27H31F2O7- — CID 156684970
2,2-difluoro-4-methyl-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypentanoate (PubChem CID 156684970) has the molecular formula C27H31F2O7- and a molecular weight of 505.53 g/mol. Its IUPAC name is 2,2-difluoro-4-methyl-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypentanoate.
| Compound Name | 2,2-difluoro-4-methyl-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypentanoate |
|---|---|
| PubChem CID | 156684970 |
| Molecular Formula | C27H31F2O7- |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2,2-difluoro-4-methyl-3-[4-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxycarbonyloxy]benzoyl]oxypentanoate |
| SMILES | CC(C)C(OC(=O)c1ccc(OC(=O)OC2(C)CC3CC2C2C4CCC(C4)C32)cc1)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C27H32F2O7/c1-13(2)22(27(28,29)24(31)32)35-23(30)14-6-8-18(9-7-14)34-25(33)36-26(3)12-17-11-19(26)21-16-5-4-15(10-16)20(17)21/h6-9,13,15-17,19-22H,4-5,10-12H2,1-3H3,(H,31,32)/p-1 |
| InChIKey | ORAQTSSGHUQXID-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|