C22H41N5O7S2 — CID 156685361
3-[2-[[2-(2,2-dimethylbutanoylamino)-4-[2-(2-isothiocyanatoethoxy)ethylamino]-4-oxobutanoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 156685361) has the molecular formula C22H41N5O7S2 and a molecular weight of 551.73 g/mol. Its IUPAC name is 3-[2-[[2-(2,2-dimethylbutanoylamino)-4-[2-(2-isothiocyanatoethoxy)ethylamino]-4-oxobutanoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[2-[[2-(2,2-dimethylbutanoylamino)-4-[2-(2-isothiocyanatoethoxy)ethylamino]-4-oxobutanoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 156685361 |
| Molecular Formula | C22H41N5O7S2 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 3-[2-[[2-(2,2-dimethylbutanoylamino)-4-[2-(2-isothiocyanatoethoxy)ethylamino]-4-oxobutanoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | CCC(C)(C)C(=O)NC(CC(=O)NCCOCCN=C=S)C(=O)NCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C22H41N5O7S2/c1-6-22(2,3)21(30)26-18(16-19(28)24-10-14-34-13-9-23-17-35)20(29)25-8-12-27(4,5)11-7-15-36(31,32)33/h18H,6-16H2,1-5H3,(H3-,24,25,26,28,29,30,31,32,33) |
| InChIKey | WLFLNWDGPTUWQX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|