C23H45N4O8S+ — CID 156685364
2-[[2-(2,2-dimethylbutanoylamino)-4-[2-[2-(oxiran-2-yl)ethoxy]ethylamino]-4-oxobutanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 156685364) has the molecular formula C23H45N4O8S+ and a molecular weight of 537.70 g/mol. Its IUPAC name is 2-[[2-(2,2-dimethylbutanoylamino)-4-[2-[2-(oxiran-2-yl)ethoxy]ethylamino]-4-oxobutanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 2-[[2-(2,2-dimethylbutanoylamino)-4-[2-[2-(oxiran-2-yl)ethoxy]ethylamino]-4-oxobutanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 156685364 |
| Molecular Formula | C23H45N4O8S+ |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 2-[[2-(2,2-dimethylbutanoylamino)-4-[2-[2-(oxiran-2-yl)ethoxy]ethylamino]-4-oxobutanoyl]amino]ethyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | CCC(C)(C)C(=O)NC(CC(=O)NCCOCCC1CO1)C(=O)NCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C23H44N4O8S/c1-6-23(2,3)22(30)26-19(16-20(28)24-10-14-34-13-8-18-17-35-18)21(29)25-9-12-27(4,5)11-7-15-36(31,32)33/h18-19H,6-17H2,1-5H3,(H3-,24,25,26,28,29,30,31,32,33)/p+1 |
| InChIKey | KKJBEXOIPJFWQP-UHFFFAOYSA-O |
| XLogP | -0.31 |
| TPSA | 163.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|