C31H32N4O — CID 156685495
(5aR,6R,9aS)-3-[cyclobutyl(methyl)amino]-8-isocyano-6,9a-dimethyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one (PubChem CID 156685495) has the molecular formula C31H32N4O and a molecular weight of 476.62 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-[cyclobutyl(methyl)amino]-8-isocyano-6,9a-dimethyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one.
| Compound Name | (5aR,6R,9aS)-3-[cyclobutyl(methyl)amino]-8-isocyano-6,9a-dimethyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 156685495 |
| Molecular Formula | C31H32N4O |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (5aR,6R,9aS)-3-[cyclobutyl(methyl)amino]-8-isocyano-6,9a-dimethyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3c(c(N(C)C4CCC4)nn3-c3ccc(-c4ccccc4)cc3)CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C31H32N4O/c1-20-26-18-17-25-29(31(26,2)19-27(32-3)28(20)36)35(33-30(25)34(4)23-11-8-12-23)24-15-13-22(14-16-24)21-9-6-5-7-10-21/h5-7,9-10,13-16,19-20,23,26H,8,11-12,17-18H2,1-2,4H3/t20-,26-,31-/m1/s1 |
| InChIKey | ZNPKUPQRDFHOBD-SBAIMNNOSA-N |
| XLogP | 6.37 |
| TPSA | 42.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|