C25H15ClN2O2S2 — CID 156685635
1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-phenylindole (PubChem CID 156685635) has the molecular formula C25H15ClN2O2S2 and a molecular weight of 474.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-phenylindole.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-phenylindole |
|---|---|
| PubChem CID | 156685635 |
| Molecular Formula | C25H15ClN2O2S2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-phenylindole |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2ccccc2)n(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H15ClN2O2S2/c1-27-25-21(15-16-31-25)23-20-9-5-6-10-22(20)28(24(23)17-7-3-2-4-8-17)32(29,30)19-13-11-18(26)12-14-19/h2-16H |
| InChIKey | ZXHZXSNDZRUMHT-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|