C33H22N2O4S2 — CID 156685745
3-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]benzoic acid (PubChem CID 156685745) has the molecular formula C33H22N2O4S2 and a molecular weight of 574.68 g/mol. Its IUPAC name is 3-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]benzoic acid.
| Compound Name | 3-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 156685745 |
| Molecular Formula | C33H22N2O4S2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 3-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]benzoic acid |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2cccc(-c3cccc(C(=O)O)c3)c2)n(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C33H22N2O4S2/c1-21-13-15-26(16-14-21)41(38,39)35-29-12-4-3-11-27(29)30(28-17-18-40-32(28)34-2)31(35)24-9-5-7-22(19-24)23-8-6-10-25(20-23)33(36)37/h3-20H,1H3,(H,36,37) |
| InChIKey | RECHFPBRUGJHRB-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|