C36H19F4N3O4S — CID 156685841
4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoic acid (PubChem CID 156685841) has the molecular formula C36H19F4N3O4S and a molecular weight of 665.62 g/mol. Its IUPAC name is 4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 156685841 |
| Molecular Formula | C36H19F4N3O4S |
| Molecular Weight | 665.62 g/mol |
| Exact Mass | 665.10 |
| IUPAC Name | 4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoic acid |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1c(-c2cccc(-c3ccc(C(=O)O)cc3F)c2)n(S(=O)(=O)c2ccc(C(F)F)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C36H19F4N3O4S/c1-42-30-7-3-6-24(19-41)32(30)33-28-18-25(37)11-15-31(28)43(48(46,47)26-12-8-20(9-13-26)35(39)40)34(33)22-5-2-4-21(16-22)27-14-10-23(36(44)45)17-29(27)38/h2-18,35H,(H,44,45) |
| InChIKey | HPPWYXJXBVPPPR-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.62 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|