C34H66O2SiSn — CID 156686186
(1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[(E)-2-tributylstannylethenyl]cyclopropyl]nona-1,7-dien-4-ol (PubChem CID 156686186) has the molecular formula C34H66O2SiSn and a molecular weight of 653.70 g/mol. Its IUPAC name is (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[(E)-2-tributylstannylethenyl]cyclopropyl]nona-1,7-dien-4-ol.
| Compound Name | (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[(E)-2-tributylstannylethenyl]cyclopropyl]nona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 156686186 |
| Molecular Formula | C34H66O2SiSn |
| Molecular Weight | 653.70 g/mol |
| Exact Mass | 654.39 |
| IUPAC Name | (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[(E)-2-tributylstannylethenyl]cyclopropyl]nona-1,7-dien-4-ol |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H](O)C/C=C\[C@H]1C[C@H]1/C=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C22H39O2Si.3C4H9.Sn/c1-10-13-20(24-25(8,9)21(3,4)5)22(6,7)19(23)15-12-14-18-16-17(18)11-2;3*1-3-4-2;/h2,10-14,17-20,23H,15-16H2,1,3-9H3;3*1,3-4H2,2H3;/b11-2?,13-10+,14-12-;;;;/t17-,18+,19+,20+;;;;/m1..../s1 |
| InChIKey | MQBXCKAPFHXSRQ-NVMDNRNISA-N |
| XLogP | 10.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.70 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|