C19H42O3Si2 — CID 156686188
(E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3-trimethylsilyloxyoct-6-en-1-ol (PubChem CID 156686188) has the molecular formula C19H42O3Si2 and a molecular weight of 374.71 g/mol. Its IUPAC name is (E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3-trimethylsilyloxyoct-6-en-1-ol.
| Compound Name | (E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3-trimethylsilyloxyoct-6-en-1-ol |
|---|---|
| PubChem CID | 156686188 |
| Molecular Formula | C19H42O3Si2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (E,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-3-trimethylsilyloxyoct-6-en-1-ol |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](CCO)O[Si](C)(C)C |
| InChI | InChI=1S/C19H42O3Si2/c1-12-13-16(22-24(10,11)18(2,3)4)19(5,6)17(14-15-20)21-23(7,8)9/h12-13,16-17,20H,14-15H2,1-11H3/b13-12+/t16-,17-/m0/s1 |
| InChIKey | IYBVMGCFMOESRW-CPQFKCLQSA-N |
| XLogP | 5.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|