C34H66O2Si3 — CID 156686193
tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxy-6-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]hex-5-enoxy]-dimethylsilane (PubChem CID 156686193) has the molecular formula C34H66O2Si3 and a molecular weight of 591.16 g/mol. Its IUPAC name is tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxy-6-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]hex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxy-6-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]hex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 156686193 |
| Molecular Formula | C34H66O2Si3 |
| Molecular Weight | 591.16 g/mol |
| Exact Mass | 590.44 |
| IUPAC Name | tert-butyl-[(Z,1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxy-6-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]hex-5-enoxy]-dimethylsilane |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](C/C=C\[C@H]1C[C@H]1C#C[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C34H66O2Si3/c1-18-20-31(36-38(16,17)33(8,9)10)34(11,12)32(35-37(13,14)15)22-19-21-29-25-30(29)23-24-39(26(2)3,27(4)5)28(6)7/h18-21,26-32H,22,25H2,1-17H3/b20-18+,21-19-/t29-,30+,31-,32-/m0/s1 |
| InChIKey | FLZFSISGERQLKH-DLMKVXELSA-N |
| XLogP | 11.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.16 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|