About [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane
[(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane (PubChem CID 156686202) has the molecular formula C18H34O2Si
and a molecular weight of 310.55 g/mol. Its IUPAC name is [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane |
| PubChem CID | 156686202 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane |
| SMILES | CCOC(C#C/C=C\[Si](C(C)C)(C(C)C)C(C)C)OCC |
| InChI | InChI=1S/C18H34O2Si/c1-9-19-18(20-10-2)13-11-12-14-21(15(3)4,16(5)6)17(7)8/h12,14-18H,9-10H2,1-8H3/b14-12+ |
| InChIKey | QRKJQFSNNBHLOL-WYMLVPIESA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane?
The IUPAC name of [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane (CID 156686202) is [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane.
What is the SMILES notation for [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane?
The canonical SMILES for [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane is CCOC(C#C/C=C\[Si](C(C)C)(C(C)C)C(C)C)OCC.
What is the InChIKey of [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane?
The InChIKey is QRKJQFSNNBHLOL-WYMLVPIESA-N. The full InChI is InChI=1S/C18H34O2Si/c1-9-19-18(20-10-2)13-11-12-14-21(15(3)4,16(5)6)17(7)8/h12,14-18H,9-10H2,1-8H3/b14-12+.
What are the key properties of [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane?
[(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane has a molecular weight of 310.55 g/mol, XLogP of 5.16, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-5,5-diethoxypent-1-en-3-ynyl]-tri(propan-2-yl)silane is sourced from PubChem (CID 156686202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).