C24H36N2 — CID 156686257
2-propan-2-yl-1-[(3R)-3,4,5-trimethylcyclohexa-1,5-dien-1-yl]-3-[(5R)-3,4,5-trimethylcyclohexa-1,3-dien-1-yl]-2H-imidazole (PubChem CID 156686257) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is 2-propan-2-yl-1-[(3R)-3,4,5-trimethylcyclohexa-1,5-dien-1-yl]-3-[(5R)-3,4,5-trimethylcyclohexa-1,3-dien-1-yl]-2H-imidazole.
| Compound Name | 2-propan-2-yl-1-[(3R)-3,4,5-trimethylcyclohexa-1,5-dien-1-yl]-3-[(5R)-3,4,5-trimethylcyclohexa-1,3-dien-1-yl]-2H-imidazole |
|---|---|
| PubChem CID | 156686257 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | 2-propan-2-yl-1-[(3R)-3,4,5-trimethylcyclohexa-1,5-dien-1-yl]-3-[(5R)-3,4,5-trimethylcyclohexa-1,3-dien-1-yl]-2H-imidazole |
| SMILES | CC1=CC(N2C=CN(C3=CC(C)=C(C)[C@H](C)C3)C2C(C)C)=C[C@H](C)C1C |
| InChI | InChI=1S/C24H36N2/c1-15(2)24-25(22-11-16(3)20(7)17(4)12-22)9-10-26(24)23-13-18(5)21(8)19(6)14-23/h9-13,15-16,19-20,24H,14H2,1-8H3/t16-,19+,20?,24?/m0/s1 |
| InChIKey | QDISCJWCRUBOSP-WBZHBFDUSA-N |
| XLogP | 6.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |