About 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium
4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium (PubChem CID 156686416) has the molecular formula C6H11N2S+
and a molecular weight of 143.23 g/mol. Its IUPAC name is 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium.
Molecular Properties
| Compound Name | 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium |
| PubChem CID | 156686416 |
| Molecular Formula | C6H11N2S+ |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium |
| SMILES | CC(C)c1nsc[n+]1C |
| InChI | InChI=1S/C6H11N2S/c1-5(2)6-7-9-4-8(6)3/h4-5H,1-3H3/q+1 |
| InChIKey | VCXJROKTXOUMQC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium?
The IUPAC name of 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium (CID 156686416) is 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium.
What is the SMILES notation for 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium?
The canonical SMILES for 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium is CC(C)c1nsc[n+]1C.
What is the InChIKey of 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium?
The InChIKey is VCXJROKTXOUMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2S/c1-5(2)6-7-9-4-8(6)3/h4-5H,1-3H3/q+1.
What are the key properties of 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium?
4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium has a molecular weight of 143.23 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-propan-2-yl-1,2,4-thiadiazol-4-ium is sourced from PubChem (CID 156686416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).