C22H21NO — CID 156686701
2-(2,8-dimethyldibenzofuran-4-yl)-4-propan-2-ylpyridine (PubChem CID 156686701) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(2,8-dimethyldibenzofuran-4-yl)-4-propan-2-ylpyridine.
| Compound Name | 2-(2,8-dimethyldibenzofuran-4-yl)-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 156686701 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(2,8-dimethyldibenzofuran-4-yl)-4-propan-2-ylpyridine |
| SMILES | Cc1ccc2oc3c(-c4cc(C(C)C)ccn4)cc(C)cc3c2c1 |
| InChI | InChI=1S/C22H21NO/c1-13(2)16-7-8-23-20(12-16)19-11-15(4)10-18-17-9-14(3)5-6-21(17)24-22(18)19/h5-13H,1-4H3 |
| InChIKey | FDGJLARZFDYBNX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |