C22H31NSi — CID 156686707
trimethyl-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-pyridinyl]silane (PubChem CID 156686707) has the molecular formula C22H31NSi and a molecular weight of 337.58 g/mol. Its IUPAC name is trimethyl-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-pyridinyl]silane.
| Compound Name | trimethyl-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-pyridinyl]silane |
|---|---|
| PubChem CID | 156686707 |
| Molecular Formula | C22H31NSi |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | trimethyl-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-pyridinyl]silane |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc([Si](C)(C)C)ccn3)ccc21 |
| InChI | InChI=1S/C22H31NSi/c1-21(2)11-12-22(3,4)19-14-16(8-9-18(19)21)20-15-17(10-13-23-20)24(5,6)7/h8-10,13-15H,11-12H2,1-7H3 |
| InChIKey | QZNZZSYWRXSACR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|