C30H35N9 — CID 156686998
2-N'-tert-butyl-2-N-methyl-5-N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]-1,3-dihydroindene-2,2,5-triamine (PubChem CID 156686998) has the molecular formula C30H35N9 and a molecular weight of 521.67 g/mol. Its IUPAC name is 2-N'-tert-butyl-2-N-methyl-5-N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]-1,3-dihydroindene-2,2,5-triamine.
| Compound Name | 2-N'-tert-butyl-2-N-methyl-5-N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]-1,3-dihydroindene-2,2,5-triamine |
|---|---|
| PubChem CID | 156686998 |
| Molecular Formula | C30H35N9 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-N'-tert-butyl-2-N-methyl-5-N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]-1,3-dihydroindene-2,2,5-triamine |
| SMILES | CNC1(NC(C)(C)C)Cc2ccc(NCc3nc(-c4ccc5ncnn5c4)c(-c4cccc(C)n4)[nH]3)cc2C1 |
| InChI | InChI=1S/C30H35N9/c1-19-7-6-8-24(35-19)28-27(21-10-12-26-33-18-34-39(26)17-21)36-25(37-28)16-32-23-11-9-20-14-30(31-5,15-22(20)13-23)38-29(2,3)4/h6-13,17-18,31-32,38H,14-16H2,1-5H3,(H,36,37) |
| InChIKey | QRICXDVRCMUGDL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|