C43H44N6O5Si — CID 156688417
methyl 3-[5-(4-methoxyphenyl)-3-[1-phenyl-3-[4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]pyrazol-4-yl]-3,4-dihydropyrazole-2-carbonyl]benzoate (PubChem CID 156688417) has the molecular formula C43H44N6O5Si and a molecular weight of 752.95 g/mol. Its IUPAC name is methyl 3-[5-(4-methoxyphenyl)-3-[1-phenyl-3-[4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]pyrazol-4-yl]-3,4-dihydropyrazole-2-carbonyl]benzoate.
| Compound Name | methyl 3-[5-(4-methoxyphenyl)-3-[1-phenyl-3-[4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]pyrazol-4-yl]-3,4-dihydropyrazole-2-carbonyl]benzoate |
|---|---|
| PubChem CID | 156688417 |
| Molecular Formula | C43H44N6O5Si |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.31 |
| IUPAC Name | methyl 3-[5-(4-methoxyphenyl)-3-[1-phenyl-3-[4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]pyrazol-4-yl]-3,4-dihydropyrazole-2-carbonyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)N2N=C(c3ccc(OC)cc3)CC2c2cn(-c3ccccc3)nc2-c2ccc(-c3cn(COCC[Si](C)(C)C)cn3)cc2)c1 |
| InChI | InChI=1S/C43H44N6O5Si/c1-52-36-20-18-30(19-21-36)38-25-40(49(45-38)42(50)33-10-9-11-34(24-33)43(51)53-2)37-26-48(35-12-7-6-8-13-35)46-41(37)32-16-14-31(15-17-32)39-27-47(28-44-39)29-54-22-23-55(3,4)5/h6-21,24,26-28,40H,22-23,25,29H2,1-5H3 |
| InChIKey | YMRFQPVXOVUKEI-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|