C30H43NS2 — CID 156688554
N,N-diethyl-4-[(8'R,9'S,10'R,11'S,13'S,14'S)-13'-methylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]aniline (PubChem CID 156688554) has the molecular formula C30H43NS2 and a molecular weight of 481.82 g/mol. Its IUPAC name is N,N-diethyl-4-[(8'R,9'S,10'R,11'S,13'S,14'S)-13'-methylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]aniline.
| Compound Name | N,N-diethyl-4-[(8'R,9'S,10'R,11'S,13'S,14'S)-13'-methylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]aniline |
|---|---|
| PubChem CID | 156688554 |
| Molecular Formula | C30H43NS2 |
| Molecular Weight | 481.82 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | N,N-diethyl-4-[(8'R,9'S,10'R,11'S,13'S,14'S)-13'-methylspiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]aniline |
| SMILES | CCN(CC)c1ccc([C@H]2C[C@]3(C)CCC[C@H]3[C@@H]3CCC4=CC5(CC[C@@H]4[C@H]32)SCCS5)cc1 |
| InChI | InChI=1S/C30H43NS2/c1-4-31(5-2)23-11-8-21(9-12-23)26-20-29(3)15-6-7-27(29)25-13-10-22-19-30(32-17-18-33-30)16-14-24(22)28(25)26/h8-9,11-12,19,24-28H,4-7,10,13-18,20H2,1-3H3/t24-,25-,26+,27-,28+,29-/m0/s1 |
| InChIKey | RYPDIWMJBSUBIM-RWPQLKTESA-N |
| XLogP | 8.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|