C21H22Cl2FN3O3S — CID 156689960
4-(2-chloro-4-fluorophenyl)-6-(6-chlorohexoxymethyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylic acid (PubChem CID 156689960) has the molecular formula C21H22Cl2FN3O3S and a molecular weight of 486.40 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)-6-(6-chlorohexoxymethyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 4-(2-chloro-4-fluorophenyl)-6-(6-chlorohexoxymethyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 156689960 |
| Molecular Formula | C21H22Cl2FN3O3S |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)-6-(6-chlorohexoxymethyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylic acid |
| SMILES | O=C(O)C1=C(COCCCCCCCl)NC(c2nccs2)=NC1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H22Cl2FN3O3S/c22-7-3-1-2-4-9-30-12-16-17(21(28)29)18(14-6-5-13(24)11-15(14)23)27-19(26-16)20-25-8-10-31-20/h5-6,8,10-11,18H,1-4,7,9,12H2,(H,26,27)(H,28,29) |
| InChIKey | LMEOSOQKSZITJH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|