About lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate
lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate (PubChem CID 156690335) has the molecular formula C6H12LiO9PS
and a molecular weight of 298.13 g/mol. Its IUPAC name is lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate.
Molecular Properties
| Compound Name | lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate |
| PubChem CID | 156690335 |
| Molecular Formula | C6H12LiO9PS |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate |
| SMILES | CCOP(=O)(OCCOS(=O)(=O)[O-])C(=O)OC.[Li+] |
| InChI | InChI=1S/C6H13O9PS.Li/c1-3-13-16(8,6(7)12-2)14-4-5-15-17(9,10)11;/h3-5H2,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | JILKWPVSUIJOBN-UHFFFAOYSA-M |
| XLogP | -2.52 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate?
The IUPAC name of lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate (CID 156690335) is lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate.
What is the SMILES notation for lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate?
The canonical SMILES for lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate is CCOP(=O)(OCCOS(=O)(=O)[O-])C(=O)OC.[Li+].
What is the InChIKey of lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate?
The InChIKey is JILKWPVSUIJOBN-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13O9PS.Li/c1-3-13-16(8,6(7)12-2)14-4-5-15-17(9,10)11;/h3-5H2,1-2H3,(H,9,10,11);/q;+1/p-1.
What are the key properties of lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate?
lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate has a molecular weight of 298.13 g/mol, XLogP of -2.52, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-[ethoxy(methoxycarbonyl)phosphoryl]oxyethyl sulfate is sourced from PubChem (CID 156690335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).