About 9-chloro-[1,3]dioxolo[4,5-g]quinoline
9-chloro-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 156692579) has the molecular formula C10H6ClNO2
and a molecular weight of 207.62 g/mol. Its IUPAC name is 9-chloro-[1,3]dioxolo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 9-chloro-[1,3]dioxolo[4,5-g]quinoline |
| PubChem CID | 156692579 |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 9-chloro-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | Clc1c2c(cc3ncccc13)OCO2 |
| InChI | InChI=1S/C10H6ClNO2/c11-9-6-2-1-3-12-7(6)4-8-10(9)14-5-13-8/h1-4H,5H2 |
| InChIKey | LNCVXKXFGGWLJD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-chloro-[1,3]dioxolo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-[1,3]dioxolo[4,5-g]quinoline?
The IUPAC name of 9-chloro-[1,3]dioxolo[4,5-g]quinoline (CID 156692579) is 9-chloro-[1,3]dioxolo[4,5-g]quinoline.
What is the SMILES notation for 9-chloro-[1,3]dioxolo[4,5-g]quinoline?
The canonical SMILES for 9-chloro-[1,3]dioxolo[4,5-g]quinoline is Clc1c2c(cc3ncccc13)OCO2.
What is the InChIKey of 9-chloro-[1,3]dioxolo[4,5-g]quinoline?
The InChIKey is LNCVXKXFGGWLJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO2/c11-9-6-2-1-3-12-7(6)4-8-10(9)14-5-13-8/h1-4H,5H2.
What are the key properties of 9-chloro-[1,3]dioxolo[4,5-g]quinoline?
9-chloro-[1,3]dioxolo[4,5-g]quinoline has a molecular weight of 207.62 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-[1,3]dioxolo[4,5-g]quinoline is sourced from PubChem (CID 156692579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).