C13H16ClN3O — CID 156692785
3-[2-(methoxymethyl)phenyl]pyridine-2,6-diamine;hydrochloride (PubChem CID 156692785) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 3-[2-(methoxymethyl)phenyl]pyridine-2,6-diamine;hydrochloride.
| Compound Name | 3-[2-(methoxymethyl)phenyl]pyridine-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 156692785 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-[2-(methoxymethyl)phenyl]pyridine-2,6-diamine;hydrochloride |
| SMILES | COCc1ccccc1-c1ccc(N)nc1N.Cl |
| InChI | InChI=1S/C13H15N3O.ClH/c1-17-8-9-4-2-3-5-10(9)11-6-7-12(14)16-13(11)15;/h2-7H,8H2,1H3,(H4,14,15,16);1H |
| InChIKey | ALPZHQQDZFHTTH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |