About 1-methoxy-1,2-dihydrophenazine
1-methoxy-1,2-dihydrophenazine (PubChem CID 156693208) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-methoxy-1,2-dihydrophenazine.
Molecular Properties
| Compound Name | 1-methoxy-1,2-dihydrophenazine |
| PubChem CID | 156693208 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1-methoxy-1,2-dihydrophenazine |
| SMILES | COC1CC=Cc2nc3ccccc3nc21 |
| InChI | InChI=1S/C13H12N2O/c1-16-12-8-4-7-11-13(12)15-10-6-3-2-5-9(10)14-11/h2-7,12H,8H2,1H3 |
| InChIKey | ZJGGKZSPANFCIS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-1,2-dihydrophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1,2-dihydrophenazine?
The IUPAC name of 1-methoxy-1,2-dihydrophenazine (CID 156693208) is 1-methoxy-1,2-dihydrophenazine.
What is the SMILES notation for 1-methoxy-1,2-dihydrophenazine?
The canonical SMILES for 1-methoxy-1,2-dihydrophenazine is COC1CC=Cc2nc3ccccc3nc21.
What is the InChIKey of 1-methoxy-1,2-dihydrophenazine?
The InChIKey is ZJGGKZSPANFCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c1-16-12-8-4-7-11-13(12)15-10-6-3-2-5-9(10)14-11/h2-7,12H,8H2,1H3.
What are the key properties of 1-methoxy-1,2-dihydrophenazine?
1-methoxy-1,2-dihydrophenazine has a molecular weight of 212.25 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1,2-dihydrophenazine is sourced from PubChem (CID 156693208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).