C43H75NO2 — CID 156693441
(9Z,28Z)-19-(1-methyl-2H-pyridin-4-yl)heptatriaconta-9,28-diene-18,20-dione (PubChem CID 156693441) has the molecular formula C43H75NO2 and a molecular weight of 638.08 g/mol. Its IUPAC name is (9Z,28Z)-19-(1-methyl-2H-pyridin-4-yl)heptatriaconta-9,28-diene-18,20-dione.
| Compound Name | (9Z,28Z)-19-(1-methyl-2H-pyridin-4-yl)heptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 156693441 |
| Molecular Formula | C43H75NO2 |
| Molecular Weight | 638.08 g/mol |
| Exact Mass | 637.58 |
| IUPAC Name | (9Z,28Z)-19-(1-methyl-2H-pyridin-4-yl)heptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(C(=O)CCCCCCC/C=C\CCCCCCCC)C1=CCN(C)C=C1 |
| InChI | InChI=1S/C43H75NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-41(45)43(40-36-38-44(3)39-37-40)42(46)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,36-38,43H,4-17,22-35,39H2,1-3H3/b20-18-,21-19- |
| InChIKey | XEDGRGHBLKSEAP-AUYXYSRISA-N |
| XLogP | 13.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.08 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|