C13H18Cl2FNO — CID 156693611
4-[(2-chloro-4-fluorophenoxy)methyl]-4-methylpiperidine;hydrochloride (PubChem CID 156693611) has the molecular formula C13H18Cl2FNO and a molecular weight of 294.20 g/mol. Its IUPAC name is 4-[(2-chloro-4-fluorophenoxy)methyl]-4-methylpiperidine;hydrochloride.
| Compound Name | 4-[(2-chloro-4-fluorophenoxy)methyl]-4-methylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 156693611 |
| Molecular Formula | C13H18Cl2FNO |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-[(2-chloro-4-fluorophenoxy)methyl]-4-methylpiperidine;hydrochloride |
| SMILES | CC1(COc2ccc(F)cc2Cl)CCNCC1.Cl |
| InChI | InChI=1S/C13H17ClFNO.ClH/c1-13(4-6-16-7-5-13)9-17-12-3-2-10(15)8-11(12)14;/h2-3,8,16H,4-7,9H2,1H3;1H |
| InChIKey | AKTBSYLYNQEFCP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |