C16H16F2N4O3 — CID 156694126
methyl 4a-(difluoromethyl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxylate (PubChem CID 156694126) has the molecular formula C16H16F2N4O3 and a molecular weight of 350.33 g/mol. Its IUPAC name is methyl 4a-(difluoromethyl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxylate.
| Compound Name | methyl 4a-(difluoromethyl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 156694126 |
| Molecular Formula | C16H16F2N4O3 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | methyl 4a-(difluoromethyl)-1-(4-oxidopyrazin-4-ium-2-yl)-5,6,7,7a-tetrahydro-4H-pentaleno[2,1-d]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2c[n+]([O-])ccn2)c2c1CC1(C(F)F)CCCC21 |
| InChI | InChI=1S/C16H16F2N4O3/c1-25-14(23)12-9-7-16(15(17)18)4-2-3-10(16)13(9)22(20-12)11-8-21(24)6-5-19-11/h5-6,8,10,15H,2-4,7H2,1H3 |
| InChIKey | YMYRVPXXEPPYGL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|